(4-tert-butylphenyl) carbamate structure
|
Common Name | (4-tert-butylphenyl) carbamate | ||
|---|---|---|---|---|
| CAS Number | 52030-36-1 | Molecular Weight | 193.24200 | |
| Density | 1.068g/cm3 | Boiling Point | 315.6ºC at 760 mmHg | |
| Molecular Formula | C11H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.1ºC | |
| Name | (4-tert-butylphenyl) carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 315.6ºC at 760 mmHg |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.24200 |
| Flash Point | 139.1ºC |
| Exact Mass | 193.11000 |
| PSA | 53.31000 |
| LogP | 2.95540 |
| Index of Refraction | 1.518 |
| InChIKey | CGAWJRUQVUFKNM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OC(N)=O)cc1 |
|
~%
(4-tert-butylph... CAS#:52030-36-1 |
| Literature: Peyroux; Derappe; Tilloy; Rips 1973 , vol. 8, # 4 p. 387 - 392 |
|
~%
(4-tert-butylph... CAS#:52030-36-1 |
| Literature: Bayer and Co. Patent: DE296889 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 13, p. 780 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Phenol,p-tert-butyl-,carbamate |
| Carbamic acid,p-t-butylphenyl ester |
| p-tert-Butylphenol carbamate |
| Phenol,4-(1,1-dimethylethyl)-,carbamate |