L-Cystine N-carboxyanhydride structure
|
Common Name | L-Cystine N-carboxyanhydride | ||
|---|---|---|---|---|
| CAS Number | 51507-96-1 | Molecular Weight | 292.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-Cystine N-carboxyanhydrideL-Cystine N-carboxyanhydride can be used for synthesis of polyamino acid carrier for anti-tumor agent delivery[1]. |
| Name | bis-((R)-2,5-dioxo-oxazolidin-4-ylmethyl)-disulfide |
|---|---|
| Synonym | More Synonyms |
| Description | L-Cystine N-carboxyanhydride can be used for synthesis of polyamino acid carrier for anti-tumor agent delivery[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C8H8N2O6S2 |
|---|---|
| Molecular Weight | 292.28900 |
| Exact Mass | 291.98200 |
| PSA | 161.40000 |
| LogP | 0.29540 |
| InChIKey | AJOSXZJYTSNNSS-UHFFFAOYSA-N |
| SMILES | O=C1NC(CSSCC2NC(=O)OC2=O)C(=O)O1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Bis-((R)-2,5-dioxo-oxazolidin-4-ylmethyl)-disulfid |