1-butan-2-yl-3-(3-chlorophenyl)urea structure
|
Common Name | 1-butan-2-yl-3-(3-chlorophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 5109-53-5 | Molecular Weight | 226.70300 | |
| Density | 1.173g/cm3 | Boiling Point | 306.3ºC at 760 mmHg | |
| Molecular Formula | C11H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.1ºC | |
| Name | 1-butan-2-yl-3-(3-chlorophenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 306.3ºC at 760 mmHg |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.70300 |
| Flash Point | 139.1ºC |
| Exact Mass | 226.08700 |
| PSA | 44.62000 |
| LogP | 3.53740 |
| Index of Refraction | 1.564 |
| InChIKey | JAKSUJDWQPNXFP-UHFFFAOYSA-N |
| SMILES | CCC(C)NC(=O)Nc1cccc(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Benzoyl-7-methoxy-5-methyl-6-phenyl-1,7-dihydro-1,2-diazepin-4-on |