decyl(triphenyl)phosphanium,iodide structure
|
Common Name | decyl(triphenyl)phosphanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 51034-56-1 | Molecular Weight | 530.46400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H36IP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | decyl(triphenyl)phosphanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H36IP |
|---|---|
| Molecular Weight | 530.46400 |
| Exact Mass | 530.16000 |
| PSA | 13.59000 |
| LogP | 4.12520 |
| InChIKey | VGBHJWFEBLBTHG-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
|
~91%
decyl(triphenyl... CAS#:51034-56-1 |
| Literature: Escoula, B.; Hajjaji, N.; Rico, I.; Lattes, A. Journal of the Chemical Society, Chemical Communications, 1984 , # 18 p. 1233 - 1234 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| decyltriphenylphosphonium iodide |
| Phosphonium,decyltriphenyl-,iodide |
| triphenyldecylphosphonium iodide |