phenyl N-methyl-N-(4-nitrophenyl)carbamate structure
|
Common Name | phenyl N-methyl-N-(4-nitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 50882-34-3 | Molecular Weight | 272.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl N-methyl-N-(4-nitrophenyl)carbamate |
|---|
| Molecular Formula | C14H12N2O4 |
|---|---|
| Molecular Weight | 272.25600 |
| Exact Mass | 272.08000 |
| PSA | 75.36000 |
| LogP | 3.75320 |
| InChIKey | VEAYEDOHBVVMIS-UHFFFAOYSA-N |
| SMILES | CN(C(=O)Oc1ccccc1)c1ccc([N+](=O)[O-])cc1 |
|
~%
phenyl N-methyl... CAS#:50882-34-3 |
| Literature: Fife,T.H. et al. Journal of the American Chemical Society, 1975 , vol. 97, p. 5878 - 5882 |