(2-hydroxybenzoyl)-N-(4-phenylthiazol-2-yl)amine
Modify Date: 2025-09-11 14:00:54
(2-hydroxybenzoyl)-N-(4-phenylthiazol-2-yl)amine structure
|
Common Name | (2-hydroxybenzoyl)-N-(4-phenylthiazol-2-yl)amine | ||
|---|---|---|---|---|
| CAS Number | 50728-39-7 | Molecular Weight | 296.34400 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-hydroxybenzoyl)-N-(4-phenylthiazol-2-yl)amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C16H12N2O2S |
| Molecular Weight | 296.34400 |
| Exact Mass | 296.06200 |
| PSA | 90.46000 |
| LogP | 3.84100 |
| Index of Refraction | 1.708 |
| InChIKey | LFKFRUIOKSHGEJ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1ccccc1O |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-Phenyl-2-Salicyloylaminothiazol |