3-amino-2-chloro-5-nitronaphthalene-1,4-dione structure
|
Common Name | 3-amino-2-chloro-5-nitronaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 50711-47-2 | Molecular Weight | 252.61100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-amino-2-chloro-5-nitronaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H5ClN2O4 |
|---|---|
| Molecular Weight | 252.61100 |
| Exact Mass | 251.99400 |
| PSA | 105.98000 |
| LogP | 2.60640 |
| InChIKey | VQRYNKPNEVXKNQ-UHFFFAOYSA-N |
| SMILES | NC1=C(Cl)C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| HS Code | 2922399090 |
|---|
|
~%
3-amino-2-chlor... CAS#:50711-47-2 |
| Literature: Blackburn, Christopher Tetrahedron Letters, 2005 , vol. 46, # 9 p. 1405 - 1409 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| AmbscL04/218 |
| 2-amino-3-chloro-8-nitro-1,4-naphthoquinone |
| 1,4-Naphthalenedione,3-amino-2-chloro-5-nitro |