3,6-dibenzylidene-1,4-dimethylpiperazine-2,5-dione structure
|
Common Name | 3,6-dibenzylidene-1,4-dimethylpiperazine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 50501-11-6 | Molecular Weight | 318.36900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-dibenzylidene-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H18N2O2 |
|---|---|
| Molecular Weight | 318.36900 |
| Exact Mass | 318.13700 |
| PSA | 44.00000 |
| LogP | 0.74160 |
| InChIKey | WFIPKWCWCOEGSY-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c(=Cc2ccccc2)n(C)c(=O)c1=Cc1ccccc1 |
|
~59%
3,6-dibenzylide... CAS#:50501-11-6 |
| Literature: Ando, Shin; Grote, Amy L.; Koide, Kazunori Journal of Organic Chemistry, 2011 , vol. 76, # 4 p. 1155 - 1158 |
|
~%
3,6-dibenzylide... CAS#:50501-11-6 |
| Literature: Forster; Saville Journal of the Chemical Society, 1922 , vol. 121, p. 816 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1,4-dimethyl-3,6-dibenzylidene-2,5-dioxopiperazine |
| 3,6-dibenzylidene-1,4-dimethyl-piperazine-2,5-dione |
| 3,6-Dibenzyliden-1,4-dimethyl-piperazin-2,5-dion |