10H-phenoxazine-3,7-diamine structure
|
Common Name | 10H-phenoxazine-3,7-diamine | ||
|---|---|---|---|---|
| CAS Number | 4935-76-6 | Molecular Weight | 213.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10H-phenoxazine-3,7-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11N3O |
|---|---|
| Molecular Weight | 213.23500 |
| Exact Mass | 213.09000 |
| PSA | 73.30000 |
| LogP | 4.00070 |
| InChIKey | LBBGQVDQCQRMTI-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)Oc1cc(N)ccc1N2 |
|
~%
10H-phenoxazine... CAS#:4935-76-6 |
| Literature: Kehrmann; Saager Chemische Berichte, 1903 , vol. 36, p. 481 |
|
~%
10H-phenoxazine... CAS#:4935-76-6 |
| Literature: Creed, David; Fawcett, Newton C.; Thompson, Robert L. Journal of the Chemical Society, Chemical Communications, 1981 , # 10 p. 497 - 499 |
| phenoxazine-3,7-diyldiamine |
| Phenoxazin-3,7-diyldiamin |