Ethyl 2-(pentafluoroethoxy)propanoate
Modify Date: 2025-09-09 11:13:14
Ethyl 2-(pentafluoroethoxy)propanoate structure
|
Common Name | Ethyl 2-(pentafluoroethoxy)propanoate | ||
|---|---|---|---|---|
| CAS Number | 479024-71-0 | Molecular Weight | 236.13700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H9F5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-(pentafluoroethoxy)propanoate |
|---|
| Molecular Formula | C7H9F5O3 |
|---|---|
| Molecular Weight | 236.13700 |
| Exact Mass | 236.04700 |
| PSA | 35.53000 |
| LogP | 2.10970 |
| InChIKey | UBETZZXORCSRJC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)OC(F)(F)C(F)(F)F |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |