1-N,4-N-bis(2-nitrophenyl)benzene-1,4-diamine structure
|
Common Name | 1-N,4-N-bis(2-nitrophenyl)benzene-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 47500-72-1 | Molecular Weight | 350.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-N,4-N-bis(2-nitrophenyl)benzene-1,4-diamine |
|---|
| Molecular Formula | C18H14N4O4 |
|---|---|
| Molecular Weight | 350.32800 |
| Exact Mass | 350.10200 |
| PSA | 115.70000 |
| LogP | 6.18260 |
| InChIKey | ONKJCEGUAXRJFM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1Nc1ccc(Nc2ccccc2[N+](=O)[O-])cc1 |
|
~%
1-N,4-N-bis(2-n... CAS#:47500-72-1 |
| Literature: Manjunath Journal of the Indian Chemical Society, 1927 , vol. 4, p. 277 Chem. Zentralbl., 1927 , vol. 98, # II p. 1698 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |