2-fluoroethyl 2-diethoxyphosphinothioylsulfanyl-2-phenylacetate structure
|
Common Name | 2-fluoroethyl 2-diethoxyphosphinothioylsulfanyl-2-phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 4681-36-1 | Molecular Weight | 366.40800 | |
| Density | 1.264g/cm3 | Boiling Point | 421.2ºC at 760 mmHg | |
| Molecular Formula | C14H20FO4PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | 2-fluoroethyl 2-diethoxyphosphinothioylsulfanyl-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 421.2ºC at 760 mmHg |
| Molecular Formula | C14H20FO4PS2 |
| Molecular Weight | 366.40800 |
| Flash Point | 208.6ºC |
| Exact Mass | 366.05200 |
| PSA | 111.96000 |
| LogP | 4.92170 |
| Index of Refraction | 1.541 |
| InChIKey | IKSBWMCKMIWLDZ-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SC(C(=O)OCCF)c1ccccc1 |
| Fluoroethyl O,O-diethyldithiophosphoryl-1-phenylacetate |
| Acetic acid,mercaptophenyl-,2-fluoroethyl ester,S-ester with O,O-diethyl phosphorodithioate |
| 2-Fluoroethyl mercaptophenylacetate,O,O-diethyl phosphorodithioate |
| M 1788 |