methanesulfonic acid,1,3,3,5,5-pentamethylcyclohexan-1-amine structure
|
Common Name | methanesulfonic acid,1,3,3,5,5-pentamethylcyclohexan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 457068-92-7 | Molecular Weight | 265.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H27NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methanesulfonic acid,1,3,3,5,5-pentamethylcyclohexan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H27NO3S |
|---|---|
| Molecular Weight | 265.41300 |
| Exact Mass | 265.17100 |
| PSA | 88.77000 |
| LogP | 4.22520 |
| InChIKey | CLUKHUGGXSIGRX-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(C)(C)CC(C)(N)C1.CS(=O)(=O)O |
|
~%
methanesulfonic... CAS#:457068-92-7 |
| Literature: MERZ PHARMA GMBH and CO. KGAA; KOLLER, Herbert; PYERIN, Michael; SBROGIO, Federico Patent: WO2011/538 A1, 2011 ; |
|
~%
methanesulfonic... CAS#:457068-92-7 |
| Literature: MERZ PHARMA GMBH and CO. KGAA; KOLLER, Herbert; PYERIN, Michael; SBROGIO, Federico Patent: WO2011/538 A1, 2011 ; |
|
~%
methanesulfonic... CAS#:457068-92-7 |
| Literature: MERZ PHARMA GMBH and CO. KGAA; KOLLER, Herbert; PYERIN, Michael; SBROGIO, Federico Patent: WO2011/538 A1, 2011 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Cyclohexanamine,1,3,3,5,5-pentamethyl-,methanesulfonate |
| UNII-9M85GXG84D |
| Neramexane mesylate |
| 1-amino-1,3,3,5,5-pentamethylcyclohexane mesylate |
| 9M85GXG84D |