4-(Difluoromethoxy)-3-methoxybenzohydrazide
Modify Date: 2025-11-26 05:39:56
4-(Difluoromethoxy)-3-methoxybenzohydrazide structure
|
Common Name | 4-(Difluoromethoxy)-3-methoxybenzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 446267-81-8 | Molecular Weight | 232.18400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10F2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(Difluoromethoxy)-3-methoxybenzohydrazide |
|---|
| Molecular Formula | C9H10F2N2O3 |
|---|---|
| Molecular Weight | 232.18400 |
| Exact Mass | 232.06600 |
| PSA | 77.07000 |
| LogP | 2.17520 |
| InChIKey | KQICIEIKDVKXMK-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)NN)ccc1OC(F)F |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |