2,4-dinitro-6-(trifluoromethyl)aniline structure
|
Common Name | 2,4-dinitro-6-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 444-41-7 | Molecular Weight | 251.12000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4F3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dinitro-6-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4F3N3O4 |
|---|---|
| Molecular Weight | 251.12000 |
| Exact Mass | 251.01500 |
| PSA | 117.66000 |
| LogP | 3.73160 |
| InChIKey | VBXPHDBFAZDZOB-UHFFFAOYSA-N |
| SMILES | Nc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F |
| HS Code | 2921420090 |
|---|
|
~%
2,4-dinitro-6-(... CAS#:444-41-7 |
| Literature: Du Pont de Nemours and Co. Patent: US2194925 , 1937 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4-Dinitro-6-trifluormethyl-anilin |
| 2,4-dinitro-6-trifluoromethyl-phenylamine |
| 2,4-dinitro-6-trifluoromethyl-aniline |
| 2-amino-3,5-dinitrobenzotrifluoride |