5-(2-methoxy-4-nitrophenyl)furan-2-carbonyl chloride
Modify Date: 2025-10-04 11:09:24
5-(2-methoxy-4-nitrophenyl)furan-2-carbonyl chloride structure
|
Common Name | 5-(2-methoxy-4-nitrophenyl)furan-2-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 443123-41-9 | Molecular Weight | 281.64900 | |
| Density | 1.409g/cm3 | Boiling Point | 412.7ºC at 760 mmHg | |
| Molecular Formula | C12H8ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.4ºC | |
| Name | 5-(2-methoxy-4-nitrophenyl)furan-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.409g/cm3 |
|---|---|
| Boiling Point | 412.7ºC at 760 mmHg |
| Molecular Formula | C12H8ClNO5 |
| Molecular Weight | 281.64900 |
| Flash Point | 203.4ºC |
| Exact Mass | 281.00900 |
| PSA | 85.26000 |
| LogP | 3.76560 |
| Index of Refraction | 1.581 |
| InChIKey | KYIUXFSGISALTH-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C(=O)Cl)o1 |
| Packaging Group | II |
|---|---|
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD02257982 |