4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol,(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate,sulfuric acid,bromide structure
|
Common Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol,(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate,sulfuric acid,bromide | ||
|---|---|---|---|---|
| CAS Number | 438627-66-8 | Molecular Weight | 989.06100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C46H74BrN3O13S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol,(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate,sulfuric acid,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C46H74BrN3O13S |
|---|---|
| Molecular Weight | 989.06100 |
| Exact Mass | 987.41300 |
| PSA | 277.78000 |
| LogP | 8.03100 |
| InChIKey | FYTIZSKUAAWPPR-UHFFFAOYSA-M |
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c(CO)c1.CC(C)[N+]1(C)C2CCC1CC(OC(=O)C(CO)c1ccccc1)C2.[Br-] |
| Albuterol sulfate / ipratropium bromide |
| Albuterol sulfate mixture with Ipratropium bromide |
| Combivent Aerosol |
| Albuterol / ipratropium |
| Albuterol-ipratropium bromide mixt. |
| Albuterol and ipratropium bromide |
| C20H30NO3.2C13H21NO3.Br.H2O4S |
| Albuterol mixture with Ipratropium bromide |