2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-olate structure
|
Common Name | 2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-olate | ||
|---|---|---|---|---|
| CAS Number | 43091-21-0 | Molecular Weight | 277.34000 | |
| Density | 1.4g/cm3 | Boiling Point | 483.8ºC at 760 mmHg | |
| Molecular Formula | C17H11NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.4ºC | |
| Name | 2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-olate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 483.8ºC at 760 mmHg |
| Molecular Formula | C17H11NOS |
| Molecular Weight | 277.34000 |
| Flash Point | 246.4ºC |
| Exact Mass | 277.05600 |
| PSA | 55.40000 |
| LogP | 4.45080 |
| Index of Refraction | 1.776 |
| InChIKey | IFAKWXOFYVAAKW-UHFFFAOYSA-N |
| SMILES | O=C1C(c2ccccc2)=S=C2C=Cc3ccccc3N12 |
|
~%
2-phenyl-[1,3]t... CAS#:43091-21-0 |
| Literature: Walker, Keith A. M.; Sjogren, Eric B.; Matthews, Thomas R. Journal of Medicinal Chemistry, 1985 , vol. 28, # 11 p. 1673 - 1679 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Phenyl-thiazolo-<3,2-a>-chinolinium-3-oxid |
| 1-oxo-2-phenyl-1,2-dihydro-thiazolo[3,2-a]quinolinylium betaine |
| 2-phenyl-1,3-thiazolo[3,2-a]quinolin-1-ol |