1,1-bis(4-chlorophenoxy)-3,3-dimethylbutan-2-one structure
|
Common Name | 1,1-bis(4-chlorophenoxy)-3,3-dimethylbutan-2-one | ||
|---|---|---|---|---|
| CAS Number | 43067-49-8 | Molecular Weight | 353.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1-bis(4-chlorophenoxy)-3,3-dimethylbutan-2-one |
|---|
| Molecular Formula | C18H18Cl2O3 |
|---|---|
| Molecular Weight | 353.24000 |
| Exact Mass | 352.06300 |
| PSA | 35.53000 |
| LogP | 5.39250 |
| InChIKey | PVRXXOJVVPDUMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |