9,10-dioxoanthracene-2,7-dicarboxylic acid structure
|
Common Name | 9,10-dioxoanthracene-2,7-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 42946-22-5 | Molecular Weight | 296.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H8O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9,10-dioxoanthracene-2,7-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H8O6 |
|---|---|
| Molecular Weight | 296.23100 |
| Exact Mass | 296.03200 |
| PSA | 108.74000 |
| LogP | 1.85840 |
| InChIKey | XNKPQVUJZSWOAR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)c1cc(C(=O)O)ccc1C2=O |
|
~98%
9,10-dioxoanthr... CAS#:42946-22-5 |
| Literature: Staab, Heinz A.; Sauer, Manfred Liebigs Annalen der Chemie, 1984 , # 4 p. 742 - 760 |
|
~%
9,10-dioxoanthr... CAS#:42946-22-5 |
| Literature: Staab, Heinz A.; Sauer, Manfred Liebigs Annalen der Chemie, 1984 , # 4 p. 742 - 760 |
|
~%
9,10-dioxoanthr... CAS#:42946-22-5 |
| Literature: Morgan; Coulson Journal of the Chemical Society, 1929 , p. 2213 |
|
~%
9,10-dioxoanthr... CAS#:42946-22-5 |
| Literature: Mayer; Guenther Chemische Berichte, 1930 , vol. 63, p. 1455,1462 |
|
~%
9,10-dioxoanthr... CAS#:42946-22-5 |
| Literature: Mayer; Guenther Chemische Berichte, 1930 , vol. 63, p. 1455,1462 |
|
~%
9,10-dioxoanthr... CAS#:42946-22-5 |
| Literature: Mayer; Guenther Chemische Berichte, 1930 , vol. 63, p. 1455,1462 |
| 2,7-anthraquinone dicarboxylic acid |
| 2,7-dicarboxyanthracene-9,10-dione |
| 2,7-Anthracenedicarboxylic acid,9,10-dihydro-9,10-dioxo |
| anthraquinone-2,7-dicarboxylic acid |
| 9,10-Anthrachinon-2,7-dicarbonsaeure |
| 9,10-dioxo-9,10-dihydro-anthracene-2,7-dicarboxylic acid |
| 9,10-Dioxo-9,10-dihydro-anthracen-2,7-dicarbonsaeure |