trimethyl-[1,4,4-tris(trimethylsilyl)-5-silaspiro[4.6]undeca-6,8,10-trien-1-yl]silane structure
|
Common Name | trimethyl-[1,4,4-tris(trimethylsilyl)-5-silaspiro[4.6]undeca-6,8,10-trien-1-yl]silane | ||
|---|---|---|---|---|
| CAS Number | 427887-74-9 | Molecular Weight | 451.02800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H46Si5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[1,4,4-tris(trimethylsilyl)-5-silaspiro[4.6]undeca-6,8,10-trien-1-yl]silane |
|---|
| Molecular Formula | C22H46Si5 |
|---|---|
| Molecular Weight | 451.02800 |
| Exact Mass | 450.24500 |
| LogP | 7.98000 |
| InChIKey | ZXFCAELMCFYOEW-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1([Si](C)(C)C)CCC([Si](C)(C)C)([Si](C)(C)C)[Si]12C=CC=CC=C2 |
|
~97%
trimethyl-[1,4,... CAS#:427887-74-9 |
| Literature: Kira, Mitsuo; Ishida, Shintaro; Iwamoto, Takeaki; Kabuto, Chizuko Journal of the American Chemical Society, 2002 , vol. 124, # 15 p. 3830 - 3831 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |