N-(4-Methoxyphenyl)-N-(methylsulfonyl)glycine structure
|
Common Name | N-(4-Methoxyphenyl)-N-(methylsulfonyl)glycine | ||
|---|---|---|---|---|
| CAS Number | 425616-70-2 | Molecular Weight | 259.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO5S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | N-(4-Methoxyphenyl)-N-(methylsulfonyl)glycine |
|---|
| Molecular Formula | C10H13NO5S |
|---|---|
| Molecular Weight | 259.27900 |
| Exact Mass | 259.05100 |
| PSA | 92.29000 |
| LogP | 1.62660 |
| InChIKey | OFLIZXZYANCGDO-UHFFFAOYSA-N |
| SMILES | COc1ccc(N(CC(=O)O)S(C)(=O)=O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |