tris(4-aminophenyl) phosphate structure
|
Common Name | tris(4-aminophenyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 4232-84-2 | Molecular Weight | 371.32700 | |
| Density | 1.402g/cm3 | Boiling Point | 551.6ºC at 760 mmHg | |
| Molecular Formula | C18H18N3O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.4ºC | |
| Name | tris(4-aminophenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 551.6ºC at 760 mmHg |
| Molecular Formula | C18H18N3O4P |
| Molecular Weight | 371.32700 |
| Flash Point | 287.4ºC |
| Exact Mass | 371.10300 |
| PSA | 132.63000 |
| LogP | 5.82170 |
| Index of Refraction | 1.683 |
| InChIKey | ZYPZVOKVDNSKLP-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OP(=O)(Oc2ccc(N)cc2)Oc2ccc(N)cc2)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Triaminophenyl phosphate |
| p-aminophenyl phosphate |