4-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine,oxalic acid
Modify Date: 2025-08-26 18:57:19
![4-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine,oxalic acid Structure](https://image.chemsrc.com/caspic/342/42054-98-8.png)
4-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine,oxalic acid structure
|
Common Name | 4-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine,oxalic acid | ||
|---|---|---|---|---|
| CAS Number | 42054-98-8 | Molecular Weight | 432.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H30BrNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine,oxalic acid |
|---|
| Molecular Formula | C19H30BrNO5 |
|---|---|
| Molecular Weight | 432.34900 |
| Exact Mass | 431.13100 |
| PSA | 87.07000 |
| LogP | 3.72330 |
| InChIKey | FKRJQOJGVQNHJB-UHFFFAOYSA-N |
| SMILES | CCN(CCCC(C)Br)CCOc1c(C)cccc1C.O=C(O)C(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |