lithium,4,4-dimethylpentan-2-ylbenzene
Modify Date: 2025-09-24 23:55:21
lithium,4,4-dimethylpentan-2-ylbenzene structure
|
Common Name | lithium,4,4-dimethylpentan-2-ylbenzene | ||
|---|---|---|---|---|
| CAS Number | 42052-95-9 | Molecular Weight | 182.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19Li | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | lithium,4,4-dimethylpentan-2-ylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H19Li |
|---|---|
| Molecular Weight | 182.23100 |
| Exact Mass | 182.16500 |
| LogP | 4.06530 |
| InChIKey | QGSYOHVHGATAAS-UHFFFAOYSA-N |
| SMILES | C[C-](CC(C)(C)C)c1ccccc1.[Li+] |
|
~92%
lithium,4,4-dim... CAS#:42052-95-9 |
| Literature: Fraenkel,G.; Geckle,J.M. Journal of the American Chemical Society, 1980 , vol. 102, p. 2869 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4-dimethyl-2-lithio-2-phenylpentane |
| 2-lithio-2-phenyl-4,4-dimethylpentane |