N-ethyl-N-[5-(5-nitrofuran-2-yl)-1H-1,2,4-triazol-3-yl]nitrous amide structure
|
Common Name | N-ethyl-N-[5-(5-nitrofuran-2-yl)-1H-1,2,4-triazol-3-yl]nitrous amide | ||
|---|---|---|---|---|
| CAS Number | 41735-29-9 | Molecular Weight | 252.18700 | |
| Density | 1.77g/cm3 | Boiling Point | 463.6ºC at 760 mmHg | |
| Molecular Formula | C8H8N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.2ºC | |
| Name | N-ethyl-N-[5-(5-nitrofuran-2-yl)-1H-1,2,4-triazol-3-yl]nitrous amide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.77g/cm3 |
|---|---|
| Boiling Point | 463.6ºC at 760 mmHg |
| Molecular Formula | C8H8N6O4 |
| Molecular Weight | 252.18700 |
| Flash Point | 234.2ºC |
| Exact Mass | 252.06100 |
| PSA | 133.20000 |
| LogP | 2.00380 |
| Index of Refraction | 1.753 |
| InChIKey | INWNIQQGCWZJGD-UHFFFAOYSA-N |
| SMILES | CCN(N=O)c1n[nH]c(-c2ccc([N+](=O)[O-])o2)n1 |
| HS Code | 2934999090 |
|---|
|
~%
N-ethyl-N-[5-(5... CAS#:41735-29-9 |
| Literature: Akerblom; Campbell Journal of medicinal chemistry, 1973 , vol. 16, # 4 p. 312 - 319 |
|
~%
N-ethyl-N-[5-(5... CAS#:41735-29-9 |
| Literature: Akerblom; Campbell Journal of medicinal chemistry, 1973 , vol. 16, # 4 p. 312 - 319 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| s-Triazole,5-(N-ethyl-N-nitroso)amino-3-(5-nitro-2-furyl) |
| ethyl-[5-(5-nitro-furan-2-yl)-1H-[1,2,4]triazol-3-yl]-nitroso-amine |
| Ethylamine,N-(3-(5-nitro-2-furyl)-s-triazol-5-yl)-N-nitroso |
| 1H-1,2,4-Triazol-5-amine,N-ethyl-3-(5-nitro-2-furyl)-N-nitroso |