2,4-bis(3-ethyl-4-methyl-1,2-oxazol-5-yl)pentan-3-one structure
|
Common Name | 2,4-bis(3-ethyl-4-methyl-1,2-oxazol-5-yl)pentan-3-one | ||
|---|---|---|---|---|
| CAS Number | 41347-39-1 | Molecular Weight | 304.38400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-bis(3-ethyl-4-methyl-1,2-oxazol-5-yl)pentan-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H24N2O3 |
|---|---|
| Molecular Weight | 304.38400 |
| Exact Mass | 304.17900 |
| PSA | 69.13000 |
| LogP | 3.88050 |
| InChIKey | ASEGLWJSGICIMM-UHFFFAOYSA-N |
| SMILES | CCc1noc(C(C)C(=O)C(C)c2onc(CC)c2C)c1C |
|
~%
2,4-bis(3-ethyl... CAS#:41347-39-1 |
| Literature: Tanaka,T. et al. Journal of the Chemical Society, Chemical Communications, 1973 , p. 233 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Pentanone,2,4-bis(3-ethyl-4-methyl-5-isoxazolyl) |
| 2,4-bis-(3-ethyl-4-methyl-isoxazol-5-yl)-pentan-3-one |