N-[2-[ethoxy(methyl)phosphoryl]sulfanylethyl]-N,3-dimethylaniline structure
|
Common Name | N-[2-[ethoxy(methyl)phosphoryl]sulfanylethyl]-N,3-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 41294-01-3 | Molecular Weight | 287.35800 | |
| Density | 1.13g/cm3 | Boiling Point | 397.6ºC at 760 mmHg | |
| Molecular Formula | C13H22NO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.3ºC | |
| Name | N-[2-[ethoxy(methyl)phosphoryl]sulfanylethyl]-N,3-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 397.6ºC at 760 mmHg |
| Molecular Formula | C13H22NO2PS |
| Molecular Weight | 287.35800 |
| Flash Point | 194.3ºC |
| Exact Mass | 287.11100 |
| PSA | 64.65000 |
| LogP | 4.02380 |
| Index of Refraction | 1.546 |
| InChIKey | GXEGHECVIQDKOK-UHFFFAOYSA-N |
| SMILES | CCOP(C)(=O)SCCN(C)c1cccc(C)c1 |
| HS Code | 2930909027 |
|---|
| HS Code | 2930909027 |
|---|---|
| Summary | 2930909027 。supervision conditions:23(import license for dual-use item and technologies,export license for dual-use item and technologies)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| o-ethyl s-{2-[methyl(3-methylphenyl)amino]ethyl} methylphosphonothioate |
| Phosphonothioic acid,methyl-,O-ethyl S-(2-(methyl(3-methylphenyl)amino)ethyl) ester |
| Methylphosphonothioic acid O-ethyl S-(2-(methyl(3-methylphenyl)amino)ethyl) ester |