(2,4-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl acetate structure
|
Common Name | (2,4-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 40870-53-9 | Molecular Weight | 240.20900 | |
| Density | 1.27g/cm3 | Boiling Point | 386.9ºC at 760 mmHg | |
| Molecular Formula | C11H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.6ºC | |
| Name | (2,4-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 386.9ºC at 760 mmHg |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.20900 |
| Flash Point | 173.6ºC |
| Exact Mass | 240.06300 |
| PSA | 78.90000 |
| LogP | 0.13210 |
| Index of Refraction | 1.504 |
| InChIKey | YNXJUWMWAFIYAJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=O)C(COC(C)=O)=C(OC)C1=O |
|
~%
(2,4-dimethoxy-... CAS#:40870-53-9 |
| Literature: Lin; Cosby; Shansky; Sartorelli Journal of medicinal chemistry, 1972 , vol. 15, # 12 p. 1247 - 1252 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,6-Dimethoxy-3-(hydroxymethyl)-p-benzoquinone acetate (ester) |
| 2,5-Cyclohexadiene-1,4-dione,2-((acetyloxy)methyl)-3,5-dimethoxy |
| p-Benzoquinone,2,6-dimethoxy-3-(hydroxymethyl)-,acetate (ester) |