2,3,6,7-Tetramethyl-1,4-naphthalenedicarboxamide structure
|
Common Name | 2,3,6,7-Tetramethyl-1,4-naphthalenedicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 408539-51-5 | Molecular Weight | 270.326 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 419.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.2±28.7 °C | |
| Name | 2,3,6,7-tetramethylnaphthalene-1,4-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.0±45.0 °C at 760 mmHg |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.326 |
| Flash Point | 207.2±28.7 °C |
| Exact Mass | 270.136841 |
| PSA | 86.18000 |
| LogP | 2.76 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | IUBUFBCVRWLOCA-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(C(N)=O)c(C)c(C)c(C(N)=O)c2cc1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,4-Naphthalenedicarboxamide, 2,3,6,7-tetramethyl- |
| 1,4-Naphthalenedicarboxamide,2,3,6,7-tetramethyl |
| 2,3,6,7-Tetramethyl-naphthalene-1,4-dicarboxylic acid diamide |
| 2,3,6,7-Tetramethyl-1,4-naphthalenedicarboxamide |