(2,3,4,5,6-pentafluorophenyl)-phenyldiazene
Modify Date: 2024-01-10 19:45:05
(2,3,4,5,6-pentafluorophenyl)-phenyldiazene structure
|
Common Name | (2,3,4,5,6-pentafluorophenyl)-phenyldiazene | ||
|---|---|---|---|---|
| CAS Number | 40474-31-5 | Molecular Weight | 272.17400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H5F5N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,3,4,5,6-pentafluorophenyl)-phenyldiazene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H5F5N2 |
|---|---|
| Molecular Weight | 272.17400 |
| Exact Mass | 272.03700 |
| PSA | 24.72000 |
| LogP | 4.79750 |
| InChIKey | BMCAYVUKZRCOSD-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(N=Nc2ccccc2)c(F)c1F |
|
~65%
(2,3,4,5,6-pent... CAS#:40474-31-5 |
| Literature: Crogan, Catherine; Fields, Roy; Pratt, Albert C.; Saleem, Layla M. N.; Dawson, Peter E. Journal of Fluorine Chemistry, 1983 , vol. 22, p. 61 - 72 |
|
~53%
(2,3,4,5,6-pent... CAS#:40474-31-5 |
| Literature: Leyva, Elisa; Sagredo, Ruben; Moctezuma, Edgar Journal of Fluorine Chemistry, 2004 , vol. 125, # 5 p. 741 - 747 |
|
~14%
(2,3,4,5,6-pent... CAS#:40474-31-5 |
| Literature: Gmelin Handbook: F: PerFHalOrg.8, 3, page 55 - 151 |
|
~13%
Detail
|
| Literature: Gmelin Handbook: F: PerFHalOrg.8, 3, page 55 - 151 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:22955-57-3| 2,3,4,5,6-pentafluorophenylazobenzene |
| 2,3,4,5,6-Pentafluoroazobenzol |
| Diazene,(pentafluorophenyl)phenyl |
| 2,3,4,5,6-pentafluoroazobenzene |
| 1-(pentafluorophenyl)-2-phenyldiazene |
| pentafluoroazobenzene |
| 2,3,4,5,6-pentafluroazobenzene |
| 2,3,4,5,6-Pentafluorazobenzol |
| Pentafluorophenyl-phenyl-diazene |