4,6-dichloro-N-methyl-N-phenyl-1,3,5-triazin-2-amine structure
|
Common Name | 4,6-dichloro-N-methyl-N-phenyl-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 3995-42-4 | Molecular Weight | 255.10300 | |
| Density | 1.436g/cm3 | Boiling Point | 431.7ºC at 760 mmHg | |
| Molecular Formula | C10H8Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.9ºC | |
| Name | 4,6-dichloro-N-methyl-N-phenyl-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.436g/cm3 |
|---|---|
| Boiling Point | 431.7ºC at 760 mmHg |
| Molecular Formula | C10H8Cl2N4 |
| Molecular Weight | 255.10300 |
| Flash Point | 214.9ºC |
| Exact Mass | 254.01300 |
| PSA | 41.91000 |
| LogP | 2.94630 |
| Index of Refraction | 1.645 |
| InChIKey | OXGUSMYPAKGXRF-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)c1nc(Cl)nc(Cl)n1 |
|
~%
4,6-dichloro-N-... CAS#:3995-42-4 |
| Literature: Renfrew, A. Hunter M.; Taylor, John A.; Whitmore, James M. J.; Williams, Andrew Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994 , # 12 p. 2389 - 2394 |
|
~61%
4,6-dichloro-N-... CAS#:3995-42-4 |
| Literature: Matsuno, Toshiyuki; Kato, Masanobu; Tsuchida, Yoshio; Takahashi, Masayuki; Yaguchi, Sin-Ichi; Terada, Sumio Chemical and Pharmaceutical Bulletin, 1997 , vol. 45, # 2 p. 291 - 296 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (4,6-dichloro-[1,3,5]triazin-2-yl)-methyl-phenyl-amine |
| 2,4-dichloro-6-(N-methyl-N-phenylamino)-1,3,5-triazine |
| (dichloro-[1,3,5]triazin-2-yl)-methyl-phenyl-amine |
| 2,6-dichloro-4-N-methyl-phenylamino-1,3,5-triazine |
| 2-(N-methylanilino)-4,6-dichloro-1,3,5-triazine |
| 2,6-Dichloro-4-methylphenylamino-1,3,5-triazine |
| 2,4-DICHLORO-6-(N-METHYLANILINO)-S-TRIAZINE |
| 2,4-dichloro-6-[(N-methyl)phenylamino]-1,3,5-triazine |