N-phenylthiophene-2-sulfonamide structure
|
Common Name | N-phenylthiophene-2-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 39810-46-3 | Molecular Weight | 239.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-phenylthiophene-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9NO2S2 |
|---|---|
| Molecular Weight | 239.31400 |
| Exact Mass | 239.00700 |
| PSA | 82.79000 |
| LogP | 3.70270 |
| InChIKey | FHAKHNFPYWASFY-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1ccccc1)c1cccs1 |
|
~%
N-phenylthiophe... CAS#:39810-46-3 |
| Literature: Weitz Chemische Berichte, 1884 , vol. 17, p. 794 |
|
~%
N-phenylthiophe... CAS#:39810-46-3 |
| Literature: Arcoria, Antonio; Ballistreri, Francesco P.; Musumarra, Giuseppe; Tomaselli, Gaetano A. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1981 , p. 221 - 227 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| thiophene-2-sulfonic acid phenylamide |
| Thiophen-2-sulfonsaeure-anilid |
| N-phenyl-2-thiophenesulfonamide |
| thiophene-2-sulfonic acid anilide |
| 2-Thiophensulfonanilid |
| N-phenyl-2-thienylsulfonamide |
| 2-Thiophensulfonylanilid |