2-(2,4-dichlorophenoxy)acetic acid,2-(2,4-dichlorophenoxy)propanoic acid structure
|
Common Name | 2-(2,4-dichlorophenoxy)acetic acid,2-(2,4-dichlorophenoxy)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 39389-74-7 | Molecular Weight | 456.10100 | |
| Density | N/A | Boiling Point | 348.3ºC at 760 mmHg | |
| Molecular Formula | C17H14Cl4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.5ºC | |
| Name | 2-(2,4-dichlorophenoxy)acetic acid,2-(2,4-dichlorophenoxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 348.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H14Cl4O6 |
| Molecular Weight | 456.10100 |
| Flash Point | 164.5ºC |
| Exact Mass | 453.95400 |
| PSA | 93.06000 |
| LogP | 5.30210 |
| InChIKey | KYNIQGYTUILJAI-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)O.O=C(O)COc1ccc(Cl)cc1Cl |
| 2-(2,4-Dichlorophenoxy)propanoic acid mixt. with (2,4-dichlorophenoxy)acetic acid |
| (2,4-dichlorophenoxy)acetic acid-2-(2,4-dichlorophenoxy)propanoic acid(1:1) |
| Propanoic acid,2-(2,4-dichlorophenoxy)-,mixt. with (2,4-dichlorophenoxy)acetic acid |