4-[4-(2,4-difluorophenyl)phenyl]-4-oxobutanoic acid structure
|
Common Name | 4-[4-(2,4-difluorophenyl)phenyl]-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 39241-03-7 | Molecular Weight | 290.26100 | |
| Density | 1.305g/cm3 | Boiling Point | 453.4ºC at 760 mmHg | |
| Molecular Formula | C16H12F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228ºC | |
| Name | 4-[4-(2,4-difluorophenyl)phenyl]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 453.4ºC at 760 mmHg |
| Molecular Formula | C16H12F2O3 |
| Molecular Weight | 290.26100 |
| Flash Point | 228ºC |
| Exact Mass | 290.07500 |
| PSA | 54.37000 |
| LogP | 3.67930 |
| Index of Refraction | 1.558 |
| InChIKey | IIMOBFFVEGJVHQ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)c1ccc(-c2ccc(F)cc2F)cc1 |
| HS Code | 2918300090 |
|---|
|
~39%
4-[4-(2,4-diflu... CAS#:39241-03-7 |
| Literature: Kuchar, Miroslav; Vosatka, Vaclav; Poppova, Marie; Knezova, Eva; Panajotovova, Vladimira; et al. Collection of Czechoslovak Chemical Communications, 1995 , vol. 60, # 6 p. 1026 - 1033 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Lactonol of (Z)-4-(2',4'-difluorobiphenyl-4-yl)-3-methyl-4-oxobut-2-enoic acid |
| 4-(2',4'-difluoro-4-biphenylyl)-4-oxo-butyric acid |
| 4-(2',4'-difluorobiphenyl-4-yl)-4-oxobutanoic acid |