4,5,6-Trichloro-1H-indole-2,3-dione
Modify Date: 2025-11-26 20:14:22
4,5,6-Trichloro-1H-indole-2,3-dione structure
|
Common Name | 4,5,6-Trichloro-1H-indole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 373383-39-2 | Molecular Weight | 250.46600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H2Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5,6-Trichloro-1H-indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H2Cl3NO2 |
|---|---|
| Molecular Weight | 250.46600 |
| Exact Mass | 248.91500 |
| PSA | 46.17000 |
| LogP | 2.91960 |
| InChIKey | GPPVSDGBMRDXDG-UHFFFAOYSA-N |
| SMILES | O=C1Nc2cc(Cl)c(Cl)c(Cl)c2C1=O |
|
~%
4,5,6-Trichloro... CAS#:373383-39-2 |
| Literature: Sadler; Warren Journal of the American Chemical Society, 1956 , vol. 78, p. 1251,1254 |
| 3.4.5-Trichlor-2-hydroxy-1-methoxy-benzol |
| Phenol,6-methoxy-2,3,4-trichloro |
| 4,5,6-trichloro-indoline-2,3-dione |
| 4,5,6-Trichlor-indolin-2,3-dion |
| 2,3,4-trichloro-6-methoxy-phenol |
| 4,5,6-Trichloroguaiacol |
| 2,3,4-Trichlor-6-methoxy-phenol |
| 4,5,5-trichloroguaiacol |
| Phenol,2,3,4-trichloro-6-methoxy |
| 4,5,6-Trichloroisatin |
| 4,5,6-tricloroguaiacol |