1-benzothiophene,2,4,6-trinitrophenol structure
|
Common Name | 1-benzothiophene,2,4,6-trinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 3726-13-4 | Molecular Weight | 363.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9N3O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzothiophene,2,4,6-trinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9N3O7S |
|---|---|
| Molecular Weight | 363.30200 |
| Exact Mass | 363.01600 |
| PSA | 185.93000 |
| LogP | 5.58770 |
| InChIKey | SBBGYQKUAJHHSG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1ccc2sccc2c1 |
| benzo[b]thiophene,compound with picric acid |
| Benzo[b]thiophen,Verbindung mit Picrinsaeure |
| Benzo[b]thiophene,compd. with 2,4,6-trinitrophenol (1:1) |