N-[(4-methylphenyl)sulfonyl-phenylmethyl]cyclohexanecarboxamide structure
|
Common Name | N-[(4-methylphenyl)sulfonyl-phenylmethyl]cyclohexanecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 372199-81-0 | Molecular Weight | 371.49300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H25NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-methylphenyl)sulfonyl-phenylmethyl]cyclohexanecarboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H25NO3S |
|---|---|
| Molecular Weight | 371.49300 |
| Exact Mass | 371.15600 |
| PSA | 75.11000 |
| LogP | 6.08510 |
| InChIKey | CVZNABCKOOAIOS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C(NC(=O)C2CCCCC2)c2ccccc2)cc1 |
|
~%
N-[(4-methylphe... CAS#:372199-81-0 |
| Literature: Murry; Frantz; Soheili; Tillyer; Grabowski; Reider Journal of the American Chemical Society, 2001 , vol. 123, # 39 p. 9696 - 9697 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-[(4-methylphenylsulfonyl)(phenyl)methyl]cyclohexanecarboxamide |
| Cyclohexanecarboxamide,N-[[(4-methylphenyl)sulfonyl]phenylmethyl] |