5,10,15,20-tetrakis(2-chlorophenyl)-21,22-dihydroporphyrin
Modify Date: 2025-09-15 20:33:48
5,10,15,20-tetrakis(2-chlorophenyl)-21,22-dihydroporphyrin structure
|
Common Name | 5,10,15,20-tetrakis(2-chlorophenyl)-21,22-dihydroporphyrin | ||
|---|---|---|---|---|
| CAS Number | 37083-35-5 | Molecular Weight | 752.51600 | |
| Density | 1.398g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C44H26Cl4N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,10,15,20-tetrakis(2-chlorophenyl)-21,22-dihydroporphyrin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.398g/cm3 |
|---|---|
| Molecular Formula | C44H26Cl4N4 |
| Molecular Weight | 752.51600 |
| Exact Mass | 750.09100 |
| PSA | 56.30000 |
| LogP | 9.47980 |
| Index of Refraction | 1.702 |
| InChIKey | GEHPICAZCITNQL-UHFFFAOYSA-N |
| SMILES | Clc1ccccc1-c1c2nc(c(-c3ccccc3Cl)c3ccc([nH]3)c(-c3ccccc3Cl)c3nc(c(-c4ccccc4Cl)c4ccc1[nH]4)C=C3)C=C2 |
|
~33%
5,10,15,20-tetr... CAS#:37083-35-5 |
| Literature: Sharghi, Hashem; Beyzavi, Mohammad Hassan; Safavi, Afsaneh; Doroodmand, Mohammad Mahdi; Khalifeh, Reza Advanced Synthesis and Catalysis, 2009 , vol. 351, # 14-15 p. 2391 - 2410 |
|
~%
5,10,15,20-tetr... CAS#:37083-35-5 |
| Literature: Sharghi, Hashem; Nejad, Alireza Hassani Tetrahedron, 2004 , vol. 60, # 8 p. 1863 - 1868 |
|
~%
5,10,15,20-tetr... CAS#:37083-35-5 |
| Literature: Adam, Farook; Ooi, Wan-Ting Applied Catalysis A: General, 2012 , vol. 445-446, p. 252 - 260 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,10,15,20-tetrakis(2-chlorophenyl)porphyrin |
| meso-5,10,15,20-tetra-2-chlorophenylporphyrin |
| 5,10,15,20-tetrakis(o-chlorophenyl)porphyrin |
| 21H,23H-PORPHINE,5,10,15,20-TETRAKIS(2-CHLOROPHENYL) |
| meso-tetra(2-chlorophenyl)porphyrin |