Hordenine
Modify Date: 2025-08-27 13:41:36
Hordenine structure
|
Common Name | Hordenine | ||
|---|---|---|---|---|
| CAS Number | 3595-05-9 | Molecular Weight | 428.54300 | |
| Density | 1.026 g/cm3 | Boiling Point | 270.2ºC at 760 mmHg | |
| Molecular Formula | C20H32N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.5ºC | |
| Name | Hordenine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.026 g/cm3 |
|---|---|
| Boiling Point | 270.2ºC at 760 mmHg |
| Molecular Formula | C20H32N2O6S |
| Molecular Weight | 428.54300 |
| Flash Point | 123.5ºC |
| Exact Mass | 428.19800 |
| PSA | 129.92000 |
| LogP | 3.42060 |
| InChIKey | OIIQUBZPQJNHQK-UHFFFAOYSA-N |
| SMILES | CN(C)CCc1ccc(O)cc1.O=S(=O)(O)O |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Einecs 222-740-5 |