1,1-dichloro-1,2,2,3,3,4,4,4-octafluorobutane structure
|
Common Name | 1,1-dichloro-1,2,2,3,3,4,4,4-octafluorobutane | ||
|---|---|---|---|---|
| CAS Number | 355-23-7 | Molecular Weight | 270.93600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4Cl2F8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1-dichloro-1,2,2,3,3,4,4,4-octafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4Cl2F8 |
|---|---|
| Molecular Weight | 270.93600 |
| Exact Mass | 269.92500 |
| LogP | 3.92020 |
| InChIKey | IWGGDBDXRJTYRH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(Cl)Cl |
|
~%
1,1-dichloro-1,... CAS#:355-23-7 |
| Literature: McBee et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 3149 |
|
~%
1,1-dichloro-1,... CAS#:355-23-7 |
| Literature: McBee et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 3149 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Butane,1,1-dichloro-1,2,2,3,3,4,4,4-octafluoro |
| 1,1-dichloro-octafluoro-butane |
| 1,1-Dichlor-octafluor-butan |