1,5-diphenylpyrazole-3,4-dicarboxylic acid structure
|
Common Name | 1,5-diphenylpyrazole-3,4-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 35280-08-1 | Molecular Weight | 308.28800 | |
| Density | 1.36g/cm3 | Boiling Point | 541.8ºC at 760 mmHg | |
| Molecular Formula | C17H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.4ºC | |
| Name | 1,5-diphenylpyrazole-3,4-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 541.8ºC at 760 mmHg |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.28800 |
| Flash Point | 281.4ºC |
| Exact Mass | 308.08000 |
| PSA | 92.42000 |
| LogP | 2.93570 |
| Index of Refraction | 1.664 |
| InChIKey | NBCLBIHPGKKSNC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nn(-c2ccccc2)c(-c2ccccc2)c1C(=O)O |
|
~83%
1,5-diphenylpyr... CAS#:35280-08-1 |
| Literature: Cocco; Maccioni; Plumitallo Farmaco, Edizione Scientifica, 1985 , vol. 40, # 4 p. 272 - 284 |
|
~91%
1,5-diphenylpyr... CAS#:35280-08-1 |
| Literature: Kasimogullari, Rahmi; Arslan, B. Seckin Journal of Heterocyclic Chemistry, 2010 , vol. 47, # 5 p. 1040 - 1048 |
|
~%
1,5-diphenylpyr... CAS#:35280-08-1 |
| Literature: Cocco; Maccioni; Plumitallo Farmaco, Edizione Scientifica, 1985 , vol. 40, # 4 p. 272 - 284 |
|
~%
1,5-diphenylpyr... CAS#:35280-08-1 |
| Literature: Cocco; Maccioni; Plumitallo Farmaco, Edizione Scientifica, 1985 , vol. 40, # 4 p. 272 - 284 |
|
~%
1,5-diphenylpyr... CAS#:35280-08-1 |
| Literature: Cocco; Maccioni; Plumitallo Farmaco, Edizione Scientifica, 1985 , vol. 40, # 4 p. 272 - 284 |
| 1,5-diphenyl-1H-pyrazole-3,4-dicarboxylic acid |
| 1,5-Diphenyl-1H-pyrazol-3,4-dicarbonsaeure |
| 1,5-Diphenyl-3,4-dicarboxy-pyrazol |
| 1H-Pyrazole-3,4-dicarboxylic acid,1,5-diphenyl |