3-(4-methyl-1,3-thiazol-2-yl)benzoic acid structure
|
Common Name | 3-(4-methyl-1,3-thiazol-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 35195-86-9 | Molecular Weight | 219.26000 | |
| Density | 1.319g/cm3 | Boiling Point | 432.5ºC at 760 mmHg | |
| Molecular Formula | C11H9NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.4ºC | |
| Name | 3-(4-methyl-1,3-thiazol-2-yl)benzoic acid |
|---|
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 432.5ºC at 760 mmHg |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.26000 |
| Flash Point | 215.4ºC |
| Exact Mass | 219.03500 |
| PSA | 78.43000 |
| LogP | 2.81670 |
| Index of Refraction | 1.629 |
| InChIKey | WXENPEKCGWEERP-UHFFFAOYSA-N |
| SMILES | Cc1csc(-c2cccc(C(=O)O)c2)n1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |