2,11-dimethyl-1,3,10,12-tetrahydro-[1,3]benzoxazino[5,6-f][1,3]benzoxazine structure
|
Common Name | 2,11-dimethyl-1,3,10,12-tetrahydro-[1,3]benzoxazino[5,6-f][1,3]benzoxazine | ||
|---|---|---|---|---|
| CAS Number | 35141-72-1 | Molecular Weight | 270.32600 | |
| Density | 1.22g/cm3 | Boiling Point | 419.7ºC at 760 mmHg | |
| Molecular Formula | C16H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.6ºC | |
| Name | 2,11-dimethyl-1,3,10,12-tetrahydro-[1,3]benzoxazino[5,6-f][1,3]benzoxazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 419.7ºC at 760 mmHg |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.32600 |
| Flash Point | 128.6ºC |
| Exact Mass | 270.13700 |
| PSA | 24.94000 |
| LogP | 2.27900 |
| Index of Refraction | 1.632 |
| InChIKey | YQGMKIMQQOCLPX-UHFFFAOYSA-N |
| SMILES | CN1COc2ccc3ccc4c(c3c2C1)CN(C)CO4 |
|
~20%
2,11-dimethyl-1... CAS#:35141-72-1 |
| Literature: Talele, Harish R.; Bedekar, Ashutosh V. Organic and Biomolecular Chemistry, 2012 , vol. 10, # 43 p. 8579 - 8582 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,11-dimethyl-2,3,11,12-tetrahydro-1H,10H,-4,9-dioxa-2,11-diaza-benzo[c]phenanthrene |
| 2,11-Dimethyl-2,3,11,12-tetrahydro-1H,10H-naphtho[1,2-e,8,7-e']bis[1,3]oxazin |
| 2,11-dimethyl-2,3,11,12-tetrahydro-1H,10H-naphtho[1,2-e,8,7-e']bis[1,3]oxazine |