N'-(5-tert-butyl-2-ethoxyphenyl)-N'-(4-tert-butyl-2-ethylphenyl)oxamide
Modify Date: 2025-08-25 11:16:11
N'-(5-tert-butyl-2-ethoxyphenyl)-N'-(4-tert-butyl-2-ethylphenyl)oxamide structure
|
Common Name | N'-(5-tert-butyl-2-ethoxyphenyl)-N'-(4-tert-butyl-2-ethylphenyl)oxamide | ||
|---|---|---|---|---|
| CAS Number | 35001-51-5 | Molecular Weight | 424.57600 | |
| Density | 1.088g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H36N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(5-tert-butyl-2-ethoxyphenyl)-N'-(4-tert-butyl-2-ethylphenyl)oxamide |
|---|
| Density | 1.088g/cm3 |
|---|---|
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.57600 |
| Exact Mass | 424.27300 |
| PSA | 72.63000 |
| LogP | 6.09300 |
| Index of Refraction | 1.566 |
| InChIKey | HMYBQGXAGRYFPW-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(C)(C)C)cc1NC(=O)C(=O)Nc1ccc(C(C)(C)C)cc1CC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |