2-(tert-butylamino)-1-(3,4-dihydroxyphenyl)ethanone,hydrochloride structure
|
Common Name | 2-(tert-butylamino)-1-(3,4-dihydroxyphenyl)ethanone,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 34715-64-5 | Molecular Weight | 259.72900 | |
| Density | N/A | Boiling Point | 411.4ºC at 760mmHg | |
| Molecular Formula | C12H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.6ºC | |
| Name | 2-(tert-butylamino)-1-(3,4-dihydroxyphenyl)ethanone,hydrochloride |
|---|
| Boiling Point | 411.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.72900 |
| Flash Point | 202.6ºC |
| Exact Mass | 259.09800 |
| PSA | 69.56000 |
| LogP | 2.86150 |
| InChIKey | JQQYYKZPHGWVCC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)c1ccc(O)c(O)c1.Cl |
| HS Code | 2922509090 |
|---|
|
~%
2-(tert-butylam... CAS#:34715-64-5 |
| Literature: NATIONAL RESEARCH COUNCIL OF CANADA Patent: WO2008/92257 A1, 2008 ; Location in patent: Page/Page column 17 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |