2-[4-[(3-methyl-1-adamantyl)methyl]anilino]benzoic acid
Modify Date: 2025-08-25 12:24:44
![2-[4-[(3-methyl-1-adamantyl)methyl]anilino]benzoic acid Structure](https://image.chemsrc.com/caspic/189/34701-96-7.png)
2-[4-[(3-methyl-1-adamantyl)methyl]anilino]benzoic acid structure
|
Common Name | 2-[4-[(3-methyl-1-adamantyl)methyl]anilino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 34701-96-7 | Molecular Weight | 375.50300 | |
| Density | 1.227g/cm3 | Boiling Point | 523.5ºC at 760 mmHg | |
| Molecular Formula | C25H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.4ºC | |
| Name | 2-[4-[(3-methyl-1-adamantyl)methyl]anilino]benzoic acid |
|---|
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 523.5ºC at 760 mmHg |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.50300 |
| Flash Point | 270.4ºC |
| Exact Mass | 375.22000 |
| PSA | 49.33000 |
| LogP | 6.35040 |
| Index of Refraction | 1.654 |
| InChIKey | RLZKVDJTLMDUGA-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)CC(Cc1ccc(Nc4ccccc4C(=O)O)cc1)(C3)C2 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |