1,2,3,5,6,7-hexabromonaphthalene structure
|
Common Name | 1,2,3,5,6,7-hexabromonaphthalene | ||
|---|---|---|---|---|
| CAS Number | 33649-67-1 | Molecular Weight | 601.54700 | |
| Density | 2.726g/cm3 | Boiling Point | 520.4ºC at 760 mmHg | |
| Molecular Formula | C10H2Br6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.1ºC | |
| Name | 1,2,3,5,6,7-hexabromonaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.726g/cm3 |
|---|---|
| Boiling Point | 520.4ºC at 760 mmHg |
| Molecular Formula | C10H2Br6 |
| Molecular Weight | 601.54700 |
| Flash Point | 258.1ºC |
| Exact Mass | 595.52600 |
| LogP | 7.41480 |
| Index of Refraction | 1.753 |
| InChIKey | BBKFJDUGJWLVGG-UHFFFAOYSA-N |
| SMILES | Brc1cc2c(Br)c(Br)c(Br)cc2c(Br)c1Br |
|
~0%
1,2,3,5,6,7-hex... CAS#:33649-67-1 |
| Literature: Song; Le Noble Journal of Organic Chemistry, 1994 , vol. 59, # 1 p. 58 - 66 |
|
~%
1,2,3,5,6,7-hex... CAS#:33649-67-1 |
| Literature: Hamill,H. et al. Tetrahedron, 1971 , vol. 27, p. 4317 - 4322 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,2,3,5,6,7-Hexabrom-naphthalin |
| Naphthalene,1,2,3,5,6,7-hexabromo |