6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride
Modify Date: 2025-08-24 22:11:44
6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride structure
|
Common Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 335-52-4 | Molecular Weight | 332.49900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6ClF11O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6ClF11O |
|---|---|
| Molecular Weight | 332.49900 |
| Exact Mass | 331.94600 |
| PSA | 17.07000 |
| LogP | 3.85530 |
| InChIKey | VIFLLSOTNAVBFJ-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
|
~%
6-chloro-2,2,3,... CAS#:335-52-4 |
| Literature: Severson; Brice Journal of the American Chemical Society, 1958 , vol. 80, p. 2313,2316 |
|
~%
6-chloro-2,2,3,... CAS#:335-52-4 |
| Literature: Zapevalov,A.Ya. et al. Zhurnal Organicheskoi Khimii, 1978 , vol. 14, p. 259 - 262,239 - 242 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-Chlor-decafluor-hexanoylfluorid |
| 6-chloro-decafluoro-hexanoyl fluoride |
| Hexanoyl fluoride,6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro |