Phosphonium, triphenyl(phenylmethyl)-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1)
Modify Date: 2025-09-07 17:04:41
Phosphonium, triphenyl(phenylmethyl)-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1) structure
|
Common Name | Phosphonium, triphenyl(phenylmethyl)-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 332350-93-3 | Molecular Weight | 665.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H25F9NO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Phosphonium, triphenyl(phenylmethyl)-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1) |
|---|
| Molecular Formula | C30H25F9NO2PS |
|---|---|
| Molecular Weight | 665.5 |
C[N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1